Products 1373232-43-9
CAS 1373232-43-9 is the registry number for 2-[4-(Cyclopentylamino)-3-hydroxyphenyl]-3-hydroxybenzo[h]chromen-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(cyclopentylamino)-3-hydroxyphenyl]-3-hydroxybenzo[h]chromen-4-one (CAS 1373232-43-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 2-[4-(cyclopentylamino)-3-hydroxyphenyl]-3-hydroxybenzo[h]chromen-4-one. InChIKey: YVEKMFLWTKHYAO-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 2-[4-(cyclopentylamino)-3-hydroxyphenyl]-3-hydroxybenzo[h]chromen-4-one |
| InChIKey | YVEKMFLWTKHYAO-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=C(C=C(C=C2)C3=C(C(=O)C4=C(O3)C5=CC=CC=C5C=C4)O)O |
Computed by PubChem (NCBI)