CAS 631915-50-9 appears in our catalog under these names: Fmoc-3-aminomethyl-phenylacetic acid, 95%, Fmoc-3-AM-PhAcOH, Fmoc-(3-aminomethylphenyl)acetic acid, 98%, 98%, Fmoc-3-aminomethyl-phenylacetic acid, 96%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 50mg, 100mg, 10g.
2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid (CAS 631915-50-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid. InChIKey: YQDLUJIUWRFNCH-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid |
| InChIKey | YQDLUJIUWRFNCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=CC(=C4)CC(=O)O |
Computed by PubChem (NCBI)