CAS 882847-07-6 appears in our catalog under these names: 3-(Fmoc-4-aminophenyl)-propionic acid, 96%, Fmoc–3–(4–aminophenyl)–propionic Acid, 3-(Fmoc-4-aminophenyl)propionic acid, 3-(Fmoc-4-aminophenyl)propionic acid 95%, 3-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 25g, 10g, 1g, 5g, 250mg, 25mg, Get quote.
3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]propanoic acid (CAS 882847-07-6) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]propanoic acid. InChIKey: KPJLWYDRVBUVDL-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]propanoic acid |
| InChIKey | KPJLWYDRVBUVDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CCC(=O)O |
Computed by PubChem (NCBI)