cas: 195387-29-2 — see every product listed under this CAS number, including other names
4-(Fmoc-amino)-1-methyl-1H-pyrrole-2-carboxylic Acid, >97.0%(HPLC)(T) (CAS 195387-29-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F1314-250MG |
| cas | 195387-29-2 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 477.30 Pln | |
| TCI | 1g | 929.69 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC)(T) |
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid (CAS 195387-29-2) is a chemical compound with the molecular formula C21H18N2O4 and a molecular weight of 362.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid. InChIKey: GHRPKWXGCOWBLD-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid |
| InChIKey | GHRPKWXGCOWBLD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)