cas: 195387-29-2 — see every product listed under this CAS number, including other names
Fmoc-Py-OH (CAS 195387-29-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 25g. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | FAA4880.0500 |
| cas | 195387-29-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 500mg | 561.44 Pln | |
| Iris Biotech | 1g | 812.24 Pln | |
| Iris Biotech | 5g | 2618.00 Pln | |
| Iris Biotech | 25g | 14154.80 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid (CAS 195387-29-2) is a chemical compound with the molecular formula C21H18N2O4 and a molecular weight of 362.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid. InChIKey: GHRPKWXGCOWBLD-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid |
| InChIKey | GHRPKWXGCOWBLD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)