4-(Methylamino)-3-nitrobenzoyl chloride, 95%
cas: 82357-48-0 — see every product listed under this CAS number, including other names
4-(Methylamino)-3-nitrobenzoyl chloride, 95% (CAS 82357-48-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A753099-100mg |
| cas | 82357-48-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 859.88 Pln | |
| Ambeed | 1g | 2206.00 Pln | |
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 837.20 Pln | |
| BLDpharm | 100mg | 569.82 Pln | |
| BLDpharm | 250mg | 919.70 Pln | |
| BLDpharm | 1g | 2374.74 Pln | |
| Fluorochem | 100mg | 950.72 Pln | |
| Fluorochem | 250mg | 1554.68 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(methylamino)-3-nitrobenzoyl chloride (CAS 82357-48-0) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 4-(methylamino)-3-nitrobenzoyl chloride. InChIKey: LIRZLGQEZXAOQR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 4-(methylamino)-3-nitrobenzoyl chloride |
| InChIKey | LIRZLGQEZXAOQR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(methylamino)-3-nitrobenzoyl chloride, Benzoyl chloride, 4-(methylamino)-3-nitro-, 4-(methylamino)-3-nitrobenzoylchloride, 4-methylamino-3-nitrobenzoic acid chloride, 4-methylamino-3-nitro-benzoic acid chloride, Benzoyl chloride, 4-(methylamino)-3-nitro- (9CI), LIRZLGQEZXAOQR-UHFFFAOYSA-N, Dabigatran Etexilate Impurity 151, 4-Methylamino-3-nitrobenzoyl chloride, 4-Methylamino-3-nitro-benzoyl chloride