CAS 5540-60-3 is the registry number for N-(4-Chloro-3-nitrophenyl)acetamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
N-(4-chloro-3-nitrophenyl)acetamide (CAS 5540-60-3) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: N-(4-chloro-3-nitrophenyl)acetamide. InChIKey: QUMQBQADXFETJW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | N-(4-chloro-3-nitrophenyl)acetamide |
| InChIKey | QUMQBQADXFETJW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)