Products 1187386-38-4
CAS 1187386-38-4 is the registry number for 6-Acetamido-3-chloropicolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg.
6-acetamido-3-chloropyridine-2-carboxylic acid (CAS 1187386-38-4) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 6-acetamido-3-chloropyridine-2-carboxylic acid. InChIKey: KSBJMIADAUOHHA-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 6-acetamido-3-chloropyridine-2-carboxylic acid |
| InChIKey | KSBJMIADAUOHHA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)