CAS 1443425-14-6 appears in our catalog under these names: 5-Chloro-1h-benzimidazole-2-carboxylic acid monohydrate, 95%, 6-Chloro-1H-benzo[d]imidazole-2-carboxylic acid hydrate, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 25g, 5g, 10g, 1g, on request.
6-chloro-1H-benzimidazole-2-carboxylic acid;hydrate (CAS 1443425-14-6) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 6-chloro-1H-benzimidazole-2-carboxylic acid;hydrate. InChIKey: GSFFORBRGSPAKD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 6-chloro-1H-benzimidazole-2-carboxylic acid;hydrate |
| InChIKey | GSFFORBRGSPAKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)C(=O)O.O |
Computed by PubChem (NCBI)