Products 944390-08-3

CAS 944390-08-3 is the registry number for 2-Acetamido-5-chloroisonicotinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-acetamido-5-chloropyridine-4-carboxylic acid (CAS 944390-08-3) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 2-acetamido-5-chloropyridine-4-carboxylic acid. InChIKey: ORAHTDAWLWQGPL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClN2O3
Molecular weight214.60 g/mol
IUPAC name2-acetamido-5-chloropyridine-4-carboxylic acid
InChIKeyORAHTDAWLWQGPL-UHFFFAOYSA-N
SMILESCC(=O)NC1=NC=C(C(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)