Products 82357-48-0
CAS 82357-48-0 appears in our catalog under these names: 4-(Methylamino)-3-nitrobenzoyl chloride 95%, 4-(methylamino)-3-nitrobenzoyl chloride, 95%, 95%, 4-(METHYLAMINO)-3-NITROBENZOYL CHLORIDE, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(methylamino)-3-nitrobenzoyl chloride (CAS 82357-48-0) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 4-(methylamino)-3-nitrobenzoyl chloride. InChIKey: LIRZLGQEZXAOQR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 4-(methylamino)-3-nitrobenzoyl chloride |
| InChIKey | LIRZLGQEZXAOQR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(methylamino)-3-nitrobenzoyl chloride, Benzoyl chloride, 4-(methylamino)-3-nitro-, 4-(methylamino)-3-nitrobenzoylchloride, 4-methylamino-3-nitrobenzoic acid chloride, 4-methylamino-3-nitro-benzoic acid chloride, Benzoyl chloride, 4-(methylamino)-3-nitro- (9CI), LIRZLGQEZXAOQR-UHFFFAOYSA-N, Dabigatran Etexilate Impurity 151, 4-Methylamino-3-nitrobenzoyl chloride, 4-Methylamino-3-nitro-benzoyl chloride