cas: 1197193-32-0 — see every product listed under this CAS number, including other names
4-(Methylsulfonyl)-2-(piperazin-1-yl)benzoic acid (CAS 1197193-32-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F721819-100MG |
| cas | 1197193-32-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 981.96 Pln | |
| Fluorochem | 1g | 2137.81 Pln | |
| Fluorochem | 5g | 5969.79 Pln |
| delivery time | 3-4 weeks |
|---|
4-methylsulfonyl-2-piperazin-1-ylbenzoic acid (CAS 1197193-32-0) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 4-methylsulfonyl-2-piperazin-1-ylbenzoic acid. InChIKey: ASKWQQQKWKPTSH-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 4-methylsulfonyl-2-piperazin-1-ylbenzoic acid |
| InChIKey | ASKWQQQKWKPTSH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)O)N2CCNCC2 |
Computed by PubChem (NCBI)