Products 24237-51-2

CAS 24237-51-2 is the registry number for 2-Amino-4,7-dihydro-5h-thieno[2,3-c]pyridine-3,6-dicarboxylic acid 6-ethyl ester 3-methyl ester, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

6-O-ethyl 3-O-methyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (CAS 24237-51-2) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 6-O-ethyl 3-O-methyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate. InChIKey: YYMWWBSMGRVGOB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16N2O4S
Molecular weight284.33 g/mol
IUPAC name6-O-ethyl 3-O-methyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate
InChIKeyYYMWWBSMGRVGOB-UHFFFAOYSA-N
SMILESCCOC(=O)N1CCC2=C(C1)SC(=C2C(=O)OC)N

Computed by PubChem (NCBI)