Products 380339-63-9

CAS 380339-63-9 is the registry number for 3-(4-Methyl-piperazine-1-sulfonyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid (CAS 380339-63-9) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: VJVSNPXBBRHNRF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16N2O4S
Molecular weight284.33 g/mol
IUPAC name3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid
InChIKeyVJVSNPXBBRHNRF-UHFFFAOYSA-N
SMILESCN1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)