Products 1197193-32-0
CAS 1197193-32-0 appears in our catalog under these names: 4-(Methylsulfonyl)-2-piperazinobenzoic acid, 95%, 4-(Methylsulfonyl)-2-piperazinobenzoic Acid, ≥95%, ≥95%, 4-(Methylsulfonyl)-2-(piperazin-1-yl)benzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-methylsulfonyl-2-piperazin-1-ylbenzoic acid (CAS 1197193-32-0) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 4-methylsulfonyl-2-piperazin-1-ylbenzoic acid. InChIKey: ASKWQQQKWKPTSH-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 4-methylsulfonyl-2-piperazin-1-ylbenzoic acid |
| InChIKey | ASKWQQQKWKPTSH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)O)N2CCNCC2 |
Computed by PubChem (NCBI)