cas: 1197193-32-0 — see every product listed under this CAS number, including other names
4-(Methylsulfonyl)-2-piperazinobenzoic Acid, ≥95%, ≥95% (CAS 1197193-32-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1100PF-100mg |
| cas | 1197193-32-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1307.60 Pln | |
| Chemat | 5g | 3621.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-methylsulfonyl-2-piperazin-1-ylbenzoic acid (CAS 1197193-32-0) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 4-methylsulfonyl-2-piperazin-1-ylbenzoic acid. InChIKey: ASKWQQQKWKPTSH-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 4-methylsulfonyl-2-piperazin-1-ylbenzoic acid |
| InChIKey | ASKWQQQKWKPTSH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)O)N2CCNCC2 |
Computed by PubChem (NCBI)