CAS 50571-61-4 appears in our catalog under these names: N-2-Nitrophenylsulfenyl-l-leucine, 95%, (S)-4-Methyl-2-(((2-nitrophenyl)thio)amino)pentanoic acid, 95+%, N–2–Nitrophenylsulfenyl–L–leucine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
(2S)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid (CAS 50571-61-4) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: (2S)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid. InChIKey: OITRGNOZDXVYFU-VIFPVBQESA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | (2S)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid |
| InChIKey | OITRGNOZDXVYFU-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NSC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)