4-(Methylsulfonyl)benzene-1-sulfonyl chloride, 95%
cas: 82964-91-8 — see every product listed under this CAS number, including other names
4-(Methylsulfonyl)benzene-1-sulfonyl chloride, 95% (CAS 82964-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A531886-100mg |
| cas | 82964-91-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 865.44 Pln | |
| Ambeed | 25g | 2873.50 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 925.25 Pln | |
| BLDpharm | 25g | 3096.71 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-methylsulfonylbenzenesulfonyl chloride (CAS 82964-91-8) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: 4-methylsulfonylbenzenesulfonyl chloride. InChIKey: TYJOQICPGZGYDT-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO4S2 |
|---|---|
| Molecular weight | 254.7 g/mol |
| IUPAC name | 4-methylsulfonylbenzenesulfonyl chloride |
| InChIKey | TYJOQICPGZGYDT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-methanesulfonylbenzene-1-sulfonyl chloride, 4-(Methylsulfonyl)benzenesulfonyl chloride, 4-methylsulfonylbenzenesulfonyl Chloride, 4-(Methylsulfonyl)benzene-1-sulfonyl chloride, 4-(methylsulphonyl)benzenesulphonyl chloride, 4-(Methylsulfonyl)benzenesulfonyl chloride, 97%, 4-methylsulfonylbenzenesulfonylchloride, 4-(Chlorosulphonyl)phenyl methyl sulphone, 4-Methanesulfonyl-benzenesulfonyl chloride, 4-(Methylsulfonyl)benzene-1-sulfonylchloride