CAS 89265-35-0 appears in our catalog under these names: 2-(Methylsulfonyl)benzenesulfonyl chloride, 93%, 2-Methylsulfonylbenzenesulfonyl chloride, 2-(Methylsulfonyl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g.
2-methylsulfonylbenzenesulfonyl chloride (CAS 89265-35-0) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: 2-methylsulfonylbenzenesulfonyl chloride. InChIKey: XPJTUCSESGEMOI-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO4S2 |
|---|---|
| Molecular weight | 254.7 g/mol |
| IUPAC name | 2-methylsulfonylbenzenesulfonyl chloride |
| InChIKey | XPJTUCSESGEMOI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)