Products 89265-35-0

CAS 89265-35-0 appears in our catalog under these names: 2-(Methylsulfonyl)benzenesulfonyl chloride, 93%, 2-Methylsulfonylbenzenesulfonyl chloride, 2-(Methylsulfonyl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g.

2-methylsulfonylbenzenesulfonyl chloride (CAS 89265-35-0) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: 2-methylsulfonylbenzenesulfonyl chloride. InChIKey: XPJTUCSESGEMOI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO4S2
Molecular weight254.7 g/mol
IUPAC name2-methylsulfonylbenzenesulfonyl chloride
InChIKeyXPJTUCSESGEMOI-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=CC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)