CAS 5335-40-0 appears in our catalog under these names: 3–(Methylsulfonyl)benzenesulfonyl Chloride, 3-(Methylsulfonyl)benzenesulfonyl Chloride, 3-(Methylsulfonyl)benzenesulfonyl Chloride 98%, 3-(Methylsulfonyl)benzenesulfonyl chloride, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 0,25g, 2,5g, 10g.
3-methylsulfonylbenzenesulfonyl chloride (CAS 5335-40-0) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: 3-methylsulfonylbenzenesulfonyl chloride. InChIKey: CQEFJGDLGWJIRV-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO4S2 |
|---|---|
| Molecular weight | 254.7 g/mol |
| IUPAC name | 3-methylsulfonylbenzenesulfonyl chloride |
| InChIKey | CQEFJGDLGWJIRV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)