CAS 103011-38-7 appears in our catalog under these names: 3-(1,3-Dioxolan-2-yl)thiophene-2-sulfonyl chloride, 95%, 3-(1,3-Dioxolan-2-yl)thiophene-2-sulfonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 1g, 50mg.
3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride (CAS 103011-38-7) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride. InChIKey: RRTOURREASJQSR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO4S2 |
|---|---|
| Molecular weight | 254.7 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride |
| InChIKey | RRTOURREASJQSR-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(SC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)