Products 2090072-28-7

CAS 2090072-28-7 is the registry number for Methyl 5-(chlorosulfonyl)-2-methylthiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-chlorosulfonyl-2-methylthiophene-3-carboxylate (CAS 2090072-28-7) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2-methylthiophene-3-carboxylate. InChIKey: ZGKOICVLGKINGF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO4S2
Molecular weight254.7 g/mol
IUPAC namemethyl 5-chlorosulfonyl-2-methylthiophene-3-carboxylate
InChIKeyZGKOICVLGKINGF-UHFFFAOYSA-N
SMILESCC1=C(C=C(S1)S(=O)(=O)Cl)C(=O)OC

Computed by PubChem (NCBI)