CAS 175201-76-0 appears in our catalog under these names: Methyl 3-chloro-4-(methylsulfonyl)thiophene-2-carboxylate, 95+%, Methyl-3-chloro-4-methylsulfonyl-2-thiophenecarboxylate. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 250mg, 1g.
Methyl 3-chloro-4-methylsulfonylthiophene-2-carboxylate (CAS 175201-76-0) is a chemical compound with the molecular formula C7H7ClO4S2 and a molecular weight of 254.7 g/mol. IUPAC name: methyl 3-chloro-4-methylsulfonylthiophene-2-carboxylate. InChIKey: VQLZEASKJWEKDX-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO4S2 |
|---|---|
| Molecular weight | 254.7 g/mol |
| IUPAC name | methyl 3-chloro-4-methylsulfonylthiophene-2-carboxylate |
| InChIKey | VQLZEASKJWEKDX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CS1)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)