cas: 1704067-27-5 — see every product listed under this CAS number, including other names
4-(N,N-dimethylsulfamoyl)-3,5-dimethylphenylboronic acid, 95%, 95% (CAS 1704067-27-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ARDD-250mg |
| cas | 1704067-27-5 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(dimethylsulfamoyl)-3,5-dimethylphenyl]boronic acid (CAS 1704067-27-5) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-(dimethylsulfamoyl)-3,5-dimethylphenyl]boronic acid. InChIKey: LXLPZSFYAKFYEA-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-(dimethylsulfamoyl)-3,5-dimethylphenyl]boronic acid |
| InChIKey | LXLPZSFYAKFYEA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)N(C)C)C)(O)O |
Computed by PubChem (NCBI)