cas: 199181-50-5 — see every product listed under this CAS number, including other names
4-(N-(4-Chlorophenyl)sulfamoyl)benzoic acid 97% (CAS 199181-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A536773-100mg |
| cas | 199181-50-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 726.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A536773 |
4-[(4-chlorophenyl)sulfamoyl]benzoic acid (CAS 199181-50-5) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 4-[(4-chlorophenyl)sulfamoyl]benzoic acid. InChIKey: XCJFUMVQXOEQIJ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)sulfamoyl]benzoic acid |
| InChIKey | XCJFUMVQXOEQIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)