cas: 886362-14-7 — see every product listed under this CAS number, including other names
4-(Oxazol-5-yl)benzohydrazide (CAS 886362-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F441370-100MG |
| cas | 886362-14-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 1g | 1403.69 Pln | |
| Fluorochem | 5g | 3038.53 Pln |
| delivery time | 3-4 weeks |
|---|
4-(1,3-oxazol-5-yl)benzohydrazide (CAS 886362-14-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 4-(1,3-oxazol-5-yl)benzohydrazide. InChIKey: ZHYJVYAAIVMXIW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-(1,3-oxazol-5-yl)benzohydrazide |
| InChIKey | ZHYJVYAAIVMXIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CO2)C(=O)NN |
Computed by PubChem (NCBI)