cas: 81078-84-4 — see every product listed under this CAS number, including other names
4-(Piperazin-1-yl)furo[3,2-c]pyridine 95% (CAS 81078-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A240238-100mg |
| cas | 81078-84-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1366.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A240238 |
4-piperazin-1-ylfuro[3,2-c]pyridine (CAS 81078-84-4) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 4-piperazin-1-ylfuro[3,2-c]pyridine. InChIKey: LUIZVTKJWSGSPA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-piperazin-1-ylfuro[3,2-c]pyridine |
| InChIKey | LUIZVTKJWSGSPA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC3=C2C=CO3 |
Computed by PubChem (NCBI)