cas: 6336-68-1 — see every product listed under this CAS number, including other names
4-(Piperidin-1-ylsulfonyl)aniline 98% (CAS 6336-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A460620-1g |
| cas | 6336-68-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1049.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A460620 |
4-piperidin-1-ylsulfonylaniline (CAS 6336-68-1) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 4-piperidin-1-ylsulfonylaniline. InChIKey: ZTTBIWZAAMPNBE-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 4-piperidin-1-ylsulfonylaniline |
| InChIKey | ZTTBIWZAAMPNBE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)