cas: 548768-98-5 — see every product listed under this CAS number, including other names
4-(Piperidin-4-yl)aniline hydrochloride 95+% (CAS 548768-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A478999-100mg |
| cas | 548768-98-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 3162.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A478999 |
4-piperidin-4-ylaniline;hydrochloride (CAS 548768-98-5) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 4-piperidin-4-ylaniline;hydrochloride. InChIKey: KCEUFLPGQSCHBJ-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 4-piperidin-4-ylaniline;hydrochloride |
| InChIKey | KCEUFLPGQSCHBJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)