cas: 548768-98-5 — see every product listed under this CAS number, including other names
4-(Piperidin-4-yl)aniline hydrochloride, 95%, 95% (CAS 548768-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D06H-100mg |
| cas | 548768-98-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 688.40 Pln | |
| Chemat | 5g | 2243.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-piperidin-4-ylaniline;hydrochloride (CAS 548768-98-5) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 4-piperidin-4-ylaniline;hydrochloride. InChIKey: KCEUFLPGQSCHBJ-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 4-piperidin-4-ylaniline;hydrochloride |
| InChIKey | KCEUFLPGQSCHBJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)