cas: 91062-38-3 — see every product listed under this CAS number, including other names
4-(Propoxycarbonyl)phenylboronic acid, 98%, 98% (CAS 91062-38-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117F1H-1g |
| cas | 91062-38-3 |
| size | 1g |
| availability | 135g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 285.20 Pln | |
| Chemat | 25g | 554.00 Pln | |
| Chemat | 100g | 1878.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-propoxycarbonylphenyl)boronic acid (CAS 91062-38-3) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (4-propoxycarbonylphenyl)boronic acid. InChIKey: XJEONFAJOXSZDX-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (4-propoxycarbonylphenyl)boronic acid |
| InChIKey | XJEONFAJOXSZDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)OCCC)(O)O |
Computed by PubChem (NCBI)