cas: 72220-51-0 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)phenoxyacetyl chloride (CAS 72220-51-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017465-1G |
| cas | 72220-51-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 674.78 Pln |
| delivery time | 2-3 weeks |
|---|
2-[4-(trifluoromethoxy)phenoxy]acetyl chloride (CAS 72220-51-0) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenoxy]acetyl chloride. InChIKey: UCKXXLDQAUINGL-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenoxy]acetyl chloride |
| InChIKey | UCKXXLDQAUINGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(=O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)