cas: 329-15-7 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzoyl chloride (CAS 329-15-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F001413-5G |
| cas | 329-15-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 362.39 Pln | |
| Fluorochem | 500g | 1388.07 Pln | |
| Fluorochem | 10g | 112.48 Pln |
| delivery time | 2-3 weeks |
|---|
4-(trifluoromethyl)benzoyl chloride (CAS 329-15-7) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 4-(trifluoromethyl)benzoyl chloride. InChIKey: OXZYBOLWRXENKT-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzoyl chloride |
| InChIKey | OXZYBOLWRXENKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)