cas: 329-15-7 — see every product listed under this CAS number, including other names
Benzoyl chloride, 4-(trifluoromethyl)-, 98%, 98% (CAS 329-15-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KBQ-5g |
| cas | 329-15-7 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 198.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethyl)benzoyl chloride (CAS 329-15-7) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 4-(trifluoromethyl)benzoyl chloride. InChIKey: OXZYBOLWRXENKT-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzoyl chloride |
| InChIKey | OXZYBOLWRXENKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)