4-(aminocarbonyl)benzenesulfonyl chloride, 97%
cas: 885526-86-3 — see every product listed under this CAS number, including other names
4-(aminocarbonyl)benzenesulfonyl chloride, 97% (CAS 885526-86-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F309869-250MG |
| cas | 885526-86-3 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 1768.15 Pln | |
| Fluorochem | 10g | 3486.29 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-carbamoylbenzenesulfonyl chloride (CAS 885526-86-3) is a chemical compound with the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. IUPAC name: 4-carbamoylbenzenesulfonyl chloride. InChIKey: YWMSSKBMOFPBDM-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 4-carbamoylbenzenesulfonyl chloride |
| InChIKey | YWMSSKBMOFPBDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)