CAS 51594-97-9 is the registry number for 4-Sulfamoylbenzoyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-sulfamoylbenzoyl chloride (CAS 51594-97-9) is a chemical compound with the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. IUPAC name: 4-sulfamoylbenzoyl chloride. InChIKey: SOSVTEHBZNSARP-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 4-sulfamoylbenzoyl chloride |
| InChIKey | SOSVTEHBZNSARP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)