CAS 873009-45-1 is the registry number for N-((5-Chloro-2-thienyl)carbonyl)glycine. Offered by: TRC. Available pack sizes: 25mg.
2-[(5-chlorothiophene-2-carbonyl)amino]acetic acid (CAS 873009-45-1) is a chemical compound with the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. IUPAC name: 2-[(5-chlorothiophene-2-carbonyl)amino]acetic acid. InChIKey: HACZPPBLNKXGCR-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 2-[(5-chlorothiophene-2-carbonyl)amino]acetic acid |
| InChIKey | HACZPPBLNKXGCR-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)