CAS 338777-32-5 appears in our catalog under these names: 5-Chloro-2-acetamidothiophene-3-carboxylic acid, 5-Chloro-2-acetamidothiophene-3-carboxylic acid, 90%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-acetamido-5-chlorothiophene-3-carboxylic acid (CAS 338777-32-5) is a chemical compound with the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. IUPAC name: 2-acetamido-5-chlorothiophene-3-carboxylic acid. InChIKey: AMCUJOWTGMNALJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 2-acetamido-5-chlorothiophene-3-carboxylic acid |
| InChIKey | AMCUJOWTGMNALJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(S1)Cl)C(=O)O |
Computed by PubChem (NCBI)