CAS 885526-86-3 appears in our catalog under these names: 4-(Chlorosulfonyl)benzamide, 95%, 4-(Aminocarbonyl)benzenesulfonyl chloride, 4-(Chlorosulfonyl)benzamide 98%, 4-(aminocarbonyl)benzenesulfonyl chloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2,5g, 100mg, 250mg, 25g.
4-carbamoylbenzenesulfonyl chloride (CAS 885526-86-3) is a chemical compound with the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. IUPAC name: 4-carbamoylbenzenesulfonyl chloride. InChIKey: YWMSSKBMOFPBDM-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 4-carbamoylbenzenesulfonyl chloride |
| InChIKey | YWMSSKBMOFPBDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)