CAS 69812-57-3 appears in our catalog under these names: 3-carbamoylbenzenesulfonyl chloride, 95%, 3-Carbamoylbenzenesulfonyl chloride, 97%, 3-(aminocarbonyl)benzenesulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 250mg, 10g, 100mg.
3-carbamoylbenzenesulfonyl chloride (CAS 69812-57-3) is a chemical compound with the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. IUPAC name: 3-carbamoylbenzenesulfonyl chloride. InChIKey: WXJXARCKFQHXST-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 3-carbamoylbenzenesulfonyl chloride |
| InChIKey | WXJXARCKFQHXST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)C(=O)N |
Computed by PubChem (NCBI)