cas: 896466-71-0 — see every product listed under this CAS number, including other names
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1h-pyrazole-3-carboxylic acid, 95% (CAS 896466-71-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-4203-5g |
| cas | 896466-71-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 2044.09 Pln | |
| Fluorochem | 10g | 3814.30 Pln | |
| Fluorochem | 25g | 8234.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid (CAS 896466-71-0) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid. InChIKey: VPTXKOPDNQVXFD-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid |
| InChIKey | VPTXKOPDNQVXFD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(NN=C1)C(=O)O |
Computed by PubChem (NCBI)