Products 1393102-03-8
CAS 1393102-03-8 appears in our catalog under these names: Methyl 2-methyl-2-(3-methyl-4-nitro-1h-pyrazol-1-yl)propanoate, 95%, Methyl 2–methyl–2–(3–methyl–4–nitro–1H–pyrazol–1–yl)propanoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-methyl-2-(3-methyl-4-nitropyrazol-1-yl)propanoate (CAS 1393102-03-8) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: methyl 2-methyl-2-(3-methyl-4-nitropyrazol-1-yl)propanoate. InChIKey: RRNRDMIVNVNMJH-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | methyl 2-methyl-2-(3-methyl-4-nitropyrazol-1-yl)propanoate |
| InChIKey | RRNRDMIVNVNMJH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1[N+](=O)[O-])C(C)(C)C(=O)OC |
Computed by PubChem (NCBI)