Products 1005640-74-3

CAS 1005640-74-3 is the registry number for 3-(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoic acid (CAS 1005640-74-3) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoic acid. InChIKey: DFANDWKEUBXWKL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13N3O4
Molecular weight227.22 g/mol
IUPAC name3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoic acid
InChIKeyDFANDWKEUBXWKL-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CC(C)C(=O)O)C)[N+](=O)[O-]

Computed by PubChem (NCBI)