CAS 1005640-74-3 is the registry number for 3-(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoic acid (CAS 1005640-74-3) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoic acid. InChIKey: DFANDWKEUBXWKL-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoic acid |
| InChIKey | DFANDWKEUBXWKL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(C)C(=O)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)