CAS 847139-22-4 appears in our catalog under these names: 3-Methyl-4-nitro-pyrazole-1-carboxylic acid tert-butyl ester, 98%, tert-Butyl 3-methyl-4-nitro-1H-pyrazole-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g.
Tert-butyl 3-methyl-4-nitropyrazole-1-carboxylate (CAS 847139-22-4) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: tert-butyl 3-methyl-4-nitropyrazole-1-carboxylate. InChIKey: BDFNCVSBBDMLAH-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | tert-butyl 3-methyl-4-nitropyrazole-1-carboxylate |
| InChIKey | BDFNCVSBBDMLAH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)