cas: 2096331-11-0 — see every product listed under this CAS number, including other names
4-Acetyl-2-methylphenylboronic acid, 97%, 97% (CAS 2096331-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHNT-100mg |
| cas | 2096331-11-0 |
| size | 100mg |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-acetyl-2-methylphenyl)boronic acid (CAS 2096331-11-0) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-acetyl-2-methylphenyl)boronic acid. InChIKey: UMMXHEAOPLVLKG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-acetyl-2-methylphenyl)boronic acid |
| InChIKey | UMMXHEAOPLVLKG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)C)C)(O)O |
Computed by PubChem (NCBI)