cas: 58728-64-6 — see every product listed under this CAS number, including other names
4-Amino-1-naphthonitrile, 97%, 97% (CAS 58728-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KNR-100mg |
| cas | 58728-64-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1854.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-aminonaphthalene-1-carbonitrile (CAS 58728-64-6) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 4-aminonaphthalene-1-carbonitrile. InChIKey: LUSIZUFVMKYWGX-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 4-aminonaphthalene-1-carbonitrile |
| InChIKey | LUSIZUFVMKYWGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2N)C#N |
Computed by PubChem (NCBI)