cas: 14861-17-7 — see every product listed under this CAS number, including other names
4-Amino-2',4'-dichlorodiphenyl ether, ≥95%, ≥95% (CAS 14861-17-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112L3L-25mg |
| cas | 14861-17-7 |
| size | 25mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 458.00 Pln | |
| Chemat | 100mg | 1163.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-(2,4-dichlorophenoxy)aniline (CAS 14861-17-7) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 4-(2,4-dichlorophenoxy)aniline. InChIKey: RWDOREOERSVIRK-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 4-(2,4-dichlorophenoxy)aniline |
| InChIKey | RWDOREOERSVIRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)