cas: 17395-99-2 — see every product listed under this CAS number, including other names
4-Amino-2-benzofuran-1,3-dione, 98% (CAS 17395-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603243-100MG |
| cas | 17395-99-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 706.02 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-2-benzofuran-1,3-dione (CAS 17395-99-2) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-amino-2-benzofuran-1,3-dione. InChIKey: DQNFPCOVVBRXOY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-amino-2-benzofuran-1,3-dione |
| InChIKey | DQNFPCOVVBRXOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)OC2=O |
Computed by PubChem (NCBI)