cas: 52834-08-9 — see every product listed under this CAS number, including other names
4-Amino-5-bromonicotinic acid, 95%, 95% (CAS 52834-08-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11484V-100mg |
| cas | 52834-08-9 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 2162.00 Pln | |
| Chemat | 10g | 2867.60 Pln | |
| Chemat | 25g | 4211.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-amino-5-bromopyridine-3-carboxylic acid (CAS 52834-08-9) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 4-amino-5-bromopyridine-3-carboxylic acid. InChIKey: HMWXBQBQGAZHEU-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 4-amino-5-bromopyridine-3-carboxylic acid |
| InChIKey | HMWXBQBQGAZHEU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)N)C(=O)O |
Computed by PubChem (NCBI)