cas: 108282-38-8 — see every product listed under this CAS number, including other names
4-Amino-5-chloro-2-ethoxybenzoic acid, 95% (CAS 108282-38-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210945-5G |
| cas | 108282-38-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 518.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-5-chloro-2-ethoxybenzoic acid (CAS 108282-38-8) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 4-amino-5-chloro-2-ethoxybenzoic acid. InChIKey: XWGYOMHQGQZRLC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 4-amino-5-chloro-2-ethoxybenzoic acid |
| InChIKey | XWGYOMHQGQZRLC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)O)Cl)N |
Computed by PubChem (NCBI)